Up a level |
Hulliger, Jürg; Wüst, Thomas; Rech, Mathias (2013). Symmetry and the polar state of condensed molecular matter. Zeitschrift für Kristallographie, 228(12), pp. 607-610. OLDENBOURG WISSENSCHAFTSVERLAG 10.1524/zkri.2013.1654
Siidra, Oleg I.; Krivovichev, Sergey V.; Armbruster, Thomas; Depmeier, Wulf (2008). Crystal chemistry of the mendipite-type system Pb(3)O(2)Cl(2)-Pb(3)O(2)Br(2). Zeitschrift für Kristallographie, 223(3), pp. 204-211. München: Oldenbourg 10.1524/zkri.2008.0018
Loosli, Claudia; Liu, Shi-Xia; Neels, Antonia; Labat, Gaël; Decurtins, Silvio (2006). Crystal structure of tetrabutylammonium-bis(phthalocyanato)terbium(III) methanol solvate hydrate, (NBu4)[TbPc2] solvate and tetrabutylammonium-bis(phthalocyanato)dysprosium(III) methanol solvate hydrate, (NBu4)[DyPc2] solvate. Zeitschrift für Kristallographie, 221, pp. 135-141. München: Oldenbourg